C15H13F2N3O3 — CID 9015092
N-[(Z)-[2-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 9015092) has the molecular formula C15H13F2N3O3 and a molecular weight of 321.28 g/mol. Its IUPAC name is N-[(Z)-[2-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[2-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 9015092 |
| Molecular Formula | C15H13F2N3O3 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-[(Z)-[2-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | COc1cccc(/C=N\NC(=O)c2ccncc2)c1OC(F)F |
| InChI | InChI=1S/C15H13F2N3O3/c1-22-12-4-2-3-11(13(12)23-15(16)17)9-19-20-14(21)10-5-7-18-8-6-10/h2-9,15H,1H3,(H,20,21)/b19-9- |
| InChIKey | MVPNAAZCGMNTQT-OCKHKDLRSA-N |
| XLogP | 2.46 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|