C14H14MnN3O3+3 — CID 50910170
manganese(2+);[2-methoxy-6-[(pyridine-4-carbonylhydrazinylidene)methyl]phenyl]oxidanium (PubChem CID 50910170) has the molecular formula C14H14MnN3O3+3 and a molecular weight of 327.22 g/mol. Its IUPAC name is manganese(2+);[2-methoxy-6-[(pyridine-4-carbonylhydrazinylidene)methyl]phenyl]oxidanium.
| Compound Name | manganese(2+);[2-methoxy-6-[(pyridine-4-carbonylhydrazinylidene)methyl]phenyl]oxidanium |
|---|---|
| PubChem CID | 50910170 |
| Molecular Formula | C14H14MnN3O3+3 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | manganese(2+);[2-methoxy-6-[(pyridine-4-carbonylhydrazinylidene)methyl]phenyl]oxidanium |
| SMILES | COc1cccc(C=NNC(=O)c2ccncc2)c1[OH2+].[Mn+2] |
| InChI | InChI=1S/C14H13N3O3.Mn/c1-20-12-4-2-3-11(13(12)18)9-16-17-14(19)10-5-7-15-8-6-10;/h2-9,18H,1H3,(H,17,19);/q;+2/p+1 |
| InChIKey | UDXMATMLMDOXAK-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|