C9H13N3O4Pd+2 — CID 50911188
[2-[(carbamoylhydrazinylidene)methyl]-6-methoxyphenyl]oxidanium;palladium(2+);hydroxide (PubChem CID 50911188) has the molecular formula C9H13N3O4Pd+2 and a molecular weight of 333.64 g/mol. Its IUPAC name is [2-[(carbamoylhydrazinylidene)methyl]-6-methoxyphenyl]oxidanium;palladium(2+);hydroxide.
| Compound Name | [2-[(carbamoylhydrazinylidene)methyl]-6-methoxyphenyl]oxidanium;palladium(2+);hydroxide |
|---|---|
| PubChem CID | 50911188 |
| Molecular Formula | C9H13N3O4Pd+2 |
| Molecular Weight | 333.64 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | [2-[(carbamoylhydrazinylidene)methyl]-6-methoxyphenyl]oxidanium;palladium(2+);hydroxide |
| SMILES | COc1cccc(C=NNC(N)=O)c1[OH2+].[OH-].[Pd+2] |
| InChI | InChI=1S/C9H11N3O3.H2O.Pd/c1-15-7-4-2-3-6(8(7)13)5-11-12-9(10)14;;/h2-5,13H,1H3,(H3,10,12,14);1H2;/q;;+2 |
| InChIKey | OGRCBMRIUMVZGI-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.64 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|