C15H16CuN2O5+2 — CID 3876946
copper;2-[[2-[(3-methoxy-2-oxoniophenyl)methylidene]hydrazinyl]-oxoniumylidenemethyl]phenolate;hydroxide (PubChem CID 3876946) has the molecular formula C15H16CuN2O5+2 and a molecular weight of 367.85 g/mol. Its IUPAC name is copper;2-[[2-[(3-methoxy-2-oxoniophenyl)methylidene]hydrazinyl]-oxoniumylidenemethyl]phenolate;hydroxide.
| Compound Name | copper;2-[[2-[(3-methoxy-2-oxoniophenyl)methylidene]hydrazinyl]-oxoniumylidenemethyl]phenolate;hydroxide |
|---|---|
| PubChem CID | 3876946 |
| Molecular Formula | C15H16CuN2O5+2 |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | copper;2-[[2-[(3-methoxy-2-oxoniophenyl)methylidene]hydrazinyl]-oxoniumylidenemethyl]phenolate;hydroxide |
| SMILES | [Cu+2].[H]/[O+]=C(/NN=Cc1cccc(OC)c1[OH2+])c1ccccc1[O-].[OH-] |
| InChI | InChI=1S/C15H14N2O4.Cu.H2O/c1-21-13-8-4-5-10(14(13)19)9-16-17-15(20)11-6-2-3-7-12(11)18;;/h2-9,18-19H,1H3,(H,17,20);;1H2/q;+2; |
| InChIKey | GGLVYDZDUVWOKA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|