C9H12CuN3O3+3 — CID 3837398
copper [amino(oxoniumylidene)methyl]-[(3-methoxy-2-oxoniophenyl)methylideneamino]azanide (PubChem CID 3837398) has the molecular formula C9H12CuN3O3+3 and a molecular weight of 273.76 g/mol. Its IUPAC name is copper [amino(oxoniumylidene)methyl]-[(3-methoxy-2-oxoniophenyl)methylideneamino]azanide.
| Compound Name | copper [amino(oxoniumylidene)methyl]-[(3-methoxy-2-oxoniophenyl)methylideneamino]azanide |
|---|---|
| PubChem CID | 3837398 |
| Molecular Formula | C9H12CuN3O3+3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | copper [amino(oxoniumylidene)methyl]-[(3-methoxy-2-oxoniophenyl)methylideneamino]azanide |
| SMILES | [Cu+2].[H]/[O+]=C(\N)[N-]N=Cc1cccc(OC)c1[OH2+] |
| InChI | InChI=1S/C9H11N3O3.Cu/c1-15-7-4-2-3-6(8(7)13)5-11-12-9(10)14;/h2-5H,1H3,(H4,10,11,12,13,14);/q;+2/p+1 |
| InChIKey | IBSFCFXCFIJERA-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 106.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|