C15H16N3O2PdS+3 — CID 135538790
[anilino(sulfoniumylidene)methyl]-[(3-methoxy-2-oxoniophenyl)methylideneamino]azanide;palladium(2+) (PubChem CID 135538790) has the molecular formula C15H16N3O2PdS+3 and a molecular weight of 408.80 g/mol. Its IUPAC name is [anilino(sulfoniumylidene)methyl]-[(3-methoxy-2-oxoniophenyl)methylideneamino]azanide;palladium(2+).
| Compound Name | [anilino(sulfoniumylidene)methyl]-[(3-methoxy-2-oxoniophenyl)methylideneamino]azanide;palladium(2+) |
|---|---|
| PubChem CID | 135538790 |
| Molecular Formula | C15H16N3O2PdS+3 |
| Molecular Weight | 408.80 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | [anilino(sulfoniumylidene)methyl]-[(3-methoxy-2-oxoniophenyl)methylideneamino]azanide;palladium(2+) |
| SMILES | [H]/[S+]=C(/[N-]N=Cc1cccc(OC)c1[OH2+])Nc1ccccc1.[Pd+2] |
| InChI | InChI=1S/C15H15N3O2S.Pd/c1-20-13-9-5-6-11(14(13)19)10-16-18-15(21)17-12-7-3-2-4-8-12;/h2-10H,1H3,(H3,16,17,18,19,21);/q;+2/p+1 |
| InChIKey | RLXQJLSWAICIRP-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.80 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|