C44H44CuN10O4S2+4 — CID 135479008
copper bis([(3-methoxy-2-oxonio-5-phenyldiazenylphenyl)methylideneamino]-[(3-methylanilino)-sulfoniumylidenemethyl]azanide) (PubChem CID 135479008) has the molecular formula C44H44CuN10O4S2+4 and a molecular weight of 904.58 g/mol. Its IUPAC name is copper bis([(3-methoxy-2-oxonio-5-phenyldiazenylphenyl)methylideneamino]-[(3-methylanilino)-sulfoniumylidenemethyl]azanide).
| Compound Name | copper bis([(3-methoxy-2-oxonio-5-phenyldiazenylphenyl)methylideneamino]-[(3-methylanilino)-sulfoniumylidenemethyl]azanide) |
|---|---|
| PubChem CID | 135479008 |
| Molecular Formula | C44H44CuN10O4S2+4 |
| Molecular Weight | 904.58 g/mol |
| Exact Mass | 903.23 |
| IUPAC Name | copper bis([(3-methoxy-2-oxonio-5-phenyldiazenylphenyl)methylideneamino]-[(3-methylanilino)-sulfoniumylidenemethyl]azanide) |
| SMILES | [Cu+2].[H]/[S+]=C(/[N-]N=Cc1cc(/N=N/c2ccccc2)cc(OC)c1[OH2+])Nc1cccc(C)c1.[H]/[S+]=C(/[N-]N=Cc1cc(/N=N/c2ccccc2)cc(OC)c1[OH2+])Nc1cccc(C)c1 |
| InChI | InChI=1S/2C22H21N5O2S.Cu/c2*1-15-7-6-10-18(11-15)24-22(30)27-23-14-16-12-19(13-20(29-2)21(16)28)26-25-17-8-4-3-5-9-17;/h2*3-14H,1-2H3,(H3,23,24,25,26,27,28,30);/q;;+2/p+2 |
| InChIKey | GAZRSEZWLINNKR-UHFFFAOYSA-P |
| XLogP | 10.08 |
| TPSA | 190.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.58 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|