C42H36N6O4 — CID 136879582
2-[[2-[(2-hydroxy-3-methoxy-5-phenyldiazenylphenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]-6-methoxy-4-phenyldiazenylphenol (PubChem CID 136879582) has the molecular formula C42H36N6O4 and a molecular weight of 688.79 g/mol. Its IUPAC name is 2-[[2-[(2-hydroxy-3-methoxy-5-phenyldiazenylphenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]-6-methoxy-4-phenyldiazenylphenol.
| Compound Name | 2-[[2-[(2-hydroxy-3-methoxy-5-phenyldiazenylphenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]-6-methoxy-4-phenyldiazenylphenol |
|---|---|
| PubChem CID | 136879582 |
| Molecular Formula | C42H36N6O4 |
| Molecular Weight | 688.79 g/mol |
| Exact Mass | 688.28 |
| IUPAC Name | 2-[[2-[(2-hydroxy-3-methoxy-5-phenyldiazenylphenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]-6-methoxy-4-phenyldiazenylphenol |
| SMILES | COc1cc(/N=N/c2ccccc2)cc(/C=N/C(c2ccccc2)C(/N=C/c2cc(/N=N/c3ccccc3)cc(OC)c2O)c2ccccc2)c1O |
| InChI | InChI=1S/C42H36N6O4/c1-51-37-25-35(47-45-33-19-11-5-12-20-33)23-31(41(37)49)27-43-39(29-15-7-3-8-16-29)40(30-17-9-4-10-18-30)44-28-32-24-36(26-38(52-2)42(32)50)48-46-34-21-13-6-14-22-34/h3-28,39-40,49-50H,1-2H3/b43-27+,44-28+,47-45+,48-46+ |
| InChIKey | KBMSAARPLCWMJW-IWFWRNQJSA-N |
| XLogP | 10.97 |
| TPSA | 133.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.79 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|