C14H17CuN4O3+3 — CID 50910692
copper;[2-[(carbamoylhydrazinylidene)methyl]-6-methoxyphenyl]oxidanium;pyridine (PubChem CID 50910692) has the molecular formula C14H17CuN4O3+3 and a molecular weight of 352.86 g/mol. Its IUPAC name is copper;[2-[(carbamoylhydrazinylidene)methyl]-6-methoxyphenyl]oxidanium;pyridine.
| Compound Name | copper;[2-[(carbamoylhydrazinylidene)methyl]-6-methoxyphenyl]oxidanium;pyridine |
|---|---|
| PubChem CID | 50910692 |
| Molecular Formula | C14H17CuN4O3+3 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | copper;[2-[(carbamoylhydrazinylidene)methyl]-6-methoxyphenyl]oxidanium;pyridine |
| SMILES | COc1cccc(C=NNC(N)=O)c1[OH2+].[Cu+2].c1ccncc1 |
| InChI | InChI=1S/C9H11N3O3.C5H5N.Cu/c1-15-7-4-2-3-6(8(7)13)5-11-12-9(10)14;1-2-4-6-5-3-1;/h2-5,13H,1H3,(H3,10,12,14);1-5H;/q;;+2/p+1 |
| InChIKey | LVRYHEMSSKNPAO-UHFFFAOYSA-O |
| XLogP | 1.21 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|