C16H16Cl3N3O3 — CID 139060030
chloroform;N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]pyridine-4-carboxamide (PubChem CID 139060030) has the molecular formula C16H16Cl3N3O3 and a molecular weight of 404.68 g/mol. Its IUPAC name is chloroform;N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]pyridine-4-carboxamide.
| Compound Name | chloroform;N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 139060030 |
| Molecular Formula | C16H16Cl3N3O3 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | chloroform;N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]pyridine-4-carboxamide |
| SMILES | COc1cccc(/C=N/NC(=O)c2ccncc2)c1OC.ClC(Cl)Cl |
| InChI | InChI=1S/C15H15N3O3.CHCl3/c1-20-13-5-3-4-12(14(13)21-2)10-17-18-15(19)11-6-8-16-9-7-11;2-1(3)4/h3-10H,1-2H3,(H,18,19);1H/b17-10+; |
| InChIKey | YHVBEDMZEXEPDY-LZMXEPDESA-N |
| XLogP | 3.85 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|