C21H16BrN3O4 — CID 6138569
[2-methoxy-6-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-bromobenzoate (PubChem CID 6138569) has the molecular formula C21H16BrN3O4 and a molecular weight of 454.28 g/mol. Its IUPAC name is [2-methoxy-6-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-bromobenzoate.
| Compound Name | [2-methoxy-6-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 6138569 |
| Molecular Formula | C21H16BrN3O4 |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | [2-methoxy-6-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-bromobenzoate |
| SMILES | COc1cccc(/C=N\NC(=O)c2ccncc2)c1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H16BrN3O4/c1-28-18-4-2-3-16(13-24-25-20(26)14-9-11-23-12-10-14)19(18)29-21(27)15-5-7-17(22)8-6-15/h2-13H,1H3,(H,25,26)/b24-13- |
| InChIKey | PITNOTVFPPNUQJ-CFRMEGHHSA-N |
| XLogP | 3.84 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|