C15H14ClN3O3 — CID 758167
N-[(2-chloro-4,5-dimethoxyphenyl)methylideneamino]pyridine-4-carboxamide (PubChem CID 758167) has the molecular formula C15H14ClN3O3 and a molecular weight of 319.75 g/mol. Its IUPAC name is N-[(2-chloro-4,5-dimethoxyphenyl)methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(2-chloro-4,5-dimethoxyphenyl)methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 758167 |
| Molecular Formula | C15H14ClN3O3 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-[(2-chloro-4,5-dimethoxyphenyl)methylideneamino]pyridine-4-carboxamide |
| SMILES | COc1cc(Cl)c(C=NNC(=O)c2ccncc2)cc1OC |
| InChI | InChI=1S/C15H14ClN3O3/c1-21-13-7-11(12(16)8-14(13)22-2)9-18-19-15(20)10-3-5-17-6-4-10/h3-9H,1-2H3,(H,19,20) |
| InChIKey | DBPGSKBJFQLUQO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|