C9H12N3O2PtS+3 — CID 50910386
[2-[(carbamothioylhydrazinylidene)methyl]-6-methoxyphenyl]oxidanium;platinum(2+) (PubChem CID 50910386) has the molecular formula C9H12N3O2PtS+3 and a molecular weight of 421.36 g/mol. Its IUPAC name is [2-[(carbamothioylhydrazinylidene)methyl]-6-methoxyphenyl]oxidanium;platinum(2+).
| Compound Name | [2-[(carbamothioylhydrazinylidene)methyl]-6-methoxyphenyl]oxidanium;platinum(2+) |
|---|---|
| PubChem CID | 50910386 |
| Molecular Formula | C9H12N3O2PtS+3 |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | [2-[(carbamothioylhydrazinylidene)methyl]-6-methoxyphenyl]oxidanium;platinum(2+) |
| SMILES | COc1cccc(C=NNC(N)=S)c1[OH2+].[Pt+2] |
| InChI | InChI=1S/C9H11N3O2S.Pt/c1-14-7-4-2-3-6(8(7)13)5-11-12-9(10)15;/h2-5,13H,1H3,(H3,10,12,15);/q;+2/p+1 |
| InChIKey | UJMIUUZBFHPQSR-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|