C9H9Cl2N3OS — CID 91352635
[(2,3-dichloro-4-methoxyphenyl)methylideneamino]thiourea (PubChem CID 91352635) has the molecular formula C9H9Cl2N3OS and a molecular weight of 278.16 g/mol. Its IUPAC name is [(2,3-dichloro-4-methoxyphenyl)methylideneamino]thiourea.
| Compound Name | [(2,3-dichloro-4-methoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 91352635 |
| Molecular Formula | C9H9Cl2N3OS |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | [(2,3-dichloro-4-methoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1ccc(C=NNC(N)=S)c(Cl)c1Cl |
| InChI | InChI=1S/C9H9Cl2N3OS/c1-15-6-3-2-5(7(10)8(6)11)4-13-14-9(12)16/h2-4H,1H3,(H3,12,14,16) |
| InChIKey | IOYPFIZOPRFKPS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|