C9H10ClN3O2S — CID 168535021
[(2-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]thiourea (PubChem CID 168535021) has the molecular formula C9H10ClN3O2S and a molecular weight of 259.72 g/mol. Its IUPAC name is [(2-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]thiourea.
| Compound Name | [(2-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 168535021 |
| Molecular Formula | C9H10ClN3O2S |
| Molecular Weight | 259.72 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | [(2-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1cc(C=NNC(N)=S)c(Cl)cc1O |
| InChI | InChI=1S/C9H10ClN3O2S/c1-15-8-2-5(4-12-13-9(11)16)6(10)3-7(8)14/h2-4,14H,1H3,(H3,11,13,16) |
| InChIKey | LFGBMHIQWHUWSP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.72 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|