C14H17N5O2S — CID 168535446
[[2-(2-imidazol-1-ylethoxy)-3-methoxyphenyl]methylideneamino]thiourea (PubChem CID 168535446) has the molecular formula C14H17N5O2S and a molecular weight of 319.39 g/mol. Its IUPAC name is [[2-(2-imidazol-1-ylethoxy)-3-methoxyphenyl]methylideneamino]thiourea.
| Compound Name | [[2-(2-imidazol-1-ylethoxy)-3-methoxyphenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 168535446 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [[2-(2-imidazol-1-ylethoxy)-3-methoxyphenyl]methylideneamino]thiourea |
| SMILES | COc1cccc(C=NNC(N)=S)c1OCCn1ccnc1 |
| InChI | InChI=1S/C14H17N5O2S/c1-20-12-4-2-3-11(9-17-18-14(15)22)13(12)21-8-7-19-6-5-16-10-19/h2-6,9-10H,7-8H2,1H3,(H3,15,18,22) |
| InChIKey | PJLCLODTPZAEIN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|