C19H19N5O5S — CID 172926035
methyl (2E)-2-[(2Z)-2-[[2-(2-imidazol-1-ylethoxy)-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926035) has the molecular formula C19H19N5O5S and a molecular weight of 429.46 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[2-(2-imidazol-1-ylethoxy)-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[2-(2-imidazol-1-ylethoxy)-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926035 |
| Molecular Formula | C19H19N5O5S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[2-(2-imidazol-1-ylethoxy)-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cccc(OC)c2OCCn2ccnc2)NC1=O |
| InChI | InChI=1S/C19H19N5O5S/c1-27-14-5-3-4-13(17(14)29-9-8-24-7-6-20-12-24)11-21-23-19-22-18(26)15(30-19)10-16(25)28-2/h3-7,10-12H,8-9H2,1-2H3,(H,22,23,26)/b15-10+,21-11? |
| InChIKey | LRSIHAQVVRSQRB-VTHFHNTBSA-N |
| XLogP | 1.58 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|