C14H15N5O3S — CID 168535752
methyl 1-[[2-[(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]pyrazole-3-carboxylate (PubChem CID 168535752) has the molecular formula C14H15N5O3S and a molecular weight of 333.37 g/mol. Its IUPAC name is methyl 1-[[2-[(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]pyrazole-3-carboxylate.
| Compound Name | methyl 1-[[2-[(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 168535752 |
| Molecular Formula | C14H15N5O3S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | methyl 1-[[2-[(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]pyrazole-3-carboxylate |
| SMILES | COC(=O)c1ccn(COc2ccccc2C=NNC(N)=S)n1 |
| InChI | InChI=1S/C14H15N5O3S/c1-21-13(20)11-6-7-19(18-11)9-22-12-5-3-2-4-10(12)8-16-17-14(15)23/h2-8H,9H2,1H3,(H3,15,17,23) |
| InChIKey | ZNPZEHZNICHDEN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|