C12H10Cl2N2O3 — CID 7017513
methyl 1-[(2,4-dichlorophenoxy)methyl]pyrazole-3-carboxylate (PubChem CID 7017513) has the molecular formula C12H10Cl2N2O3 and a molecular weight of 301.13 g/mol. Its IUPAC name is methyl 1-[(2,4-dichlorophenoxy)methyl]pyrazole-3-carboxylate.
| Compound Name | methyl 1-[(2,4-dichlorophenoxy)methyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 7017513 |
| Molecular Formula | C12H10Cl2N2O3 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | methyl 1-[(2,4-dichlorophenoxy)methyl]pyrazole-3-carboxylate |
| SMILES | COC(=O)c1ccn(COc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C12H10Cl2N2O3/c1-18-12(17)10-4-5-16(15-10)7-19-11-3-2-8(13)6-9(11)14/h2-6H,7H2,1H3 |
| InChIKey | HRLGVJKJNPAVMM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |