C14H12ClN3O3 — CID 170886336
methyl 1-[[2-chloro-4-(cyanomethyl)phenoxy]methyl]pyrazole-3-carboxylate (PubChem CID 170886336) has the molecular formula C14H12ClN3O3 and a molecular weight of 305.72 g/mol. Its IUPAC name is methyl 1-[[2-chloro-4-(cyanomethyl)phenoxy]methyl]pyrazole-3-carboxylate.
| Compound Name | methyl 1-[[2-chloro-4-(cyanomethyl)phenoxy]methyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 170886336 |
| Molecular Formula | C14H12ClN3O3 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | methyl 1-[[2-chloro-4-(cyanomethyl)phenoxy]methyl]pyrazole-3-carboxylate |
| SMILES | COC(=O)c1ccn(COc2ccc(CC#N)cc2Cl)n1 |
| InChI | InChI=1S/C14H12ClN3O3/c1-20-14(19)12-5-7-18(17-12)9-21-13-3-2-10(4-6-16)8-11(13)15/h2-3,5,7-8H,4,9H2,1H3 |
| InChIKey | DQEUTJGJUJKITO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |