C11H15N3O3 — CID 124643941
[(Z)-(4,5-dimethoxy-2-methylphenyl)methylideneamino]urea (PubChem CID 124643941) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is [(Z)-(4,5-dimethoxy-2-methylphenyl)methylideneamino]urea.
| Compound Name | [(Z)-(4,5-dimethoxy-2-methylphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 124643941 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | [(Z)-(4,5-dimethoxy-2-methylphenyl)methylideneamino]urea |
| SMILES | COc1cc(C)c(/C=N\NC(N)=O)cc1OC |
| InChI | InChI=1S/C11H15N3O3/c1-7-4-9(16-2)10(17-3)5-8(7)6-13-14-11(12)15/h4-6H,1-3H3,(H3,12,14,15)/b13-6- |
| InChIKey | HBRRDASWFRONSS-MLPAPPSSSA-N |
| XLogP | 1.01 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|