C14H18BrN3O5 — CID 168533353
ethyl 2-[5-bromo-4-[(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]propanoate (PubChem CID 168533353) has the molecular formula C14H18BrN3O5 and a molecular weight of 388.22 g/mol. Its IUPAC name is ethyl 2-[5-bromo-4-[(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]propanoate.
| Compound Name | ethyl 2-[5-bromo-4-[(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 168533353 |
| Molecular Formula | C14H18BrN3O5 |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | ethyl 2-[5-bromo-4-[(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]propanoate |
| SMILES | CCOC(=O)C(C)Oc1cc(Br)c(C=NNC(N)=O)cc1OC |
| InChI | InChI=1S/C14H18BrN3O5/c1-4-22-13(19)8(2)23-12-6-10(15)9(5-11(12)21-3)7-17-18-14(16)20/h5-8H,4H2,1-3H3,(H3,16,18,20) |
| InChIKey | SSQHLUJGSNSEEW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|