C12H14N4O7 — CID 168533162
methyl 2-[4-[(carbamoylhydrazinylidene)methyl]-2-methoxy-5-nitrophenoxy]acetate (PubChem CID 168533162) has the molecular formula C12H14N4O7 and a molecular weight of 326.27 g/mol. Its IUPAC name is methyl 2-[4-[(carbamoylhydrazinylidene)methyl]-2-methoxy-5-nitrophenoxy]acetate.
| Compound Name | methyl 2-[4-[(carbamoylhydrazinylidene)methyl]-2-methoxy-5-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 168533162 |
| Molecular Formula | C12H14N4O7 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | methyl 2-[4-[(carbamoylhydrazinylidene)methyl]-2-methoxy-5-nitrophenoxy]acetate |
| SMILES | COC(=O)COc1cc([N+](=O)[O-])c(C=NNC(N)=O)cc1OC |
| InChI | InChI=1S/C12H14N4O7/c1-21-9-3-7(5-14-15-12(13)18)8(16(19)20)4-10(9)23-6-11(17)22-2/h3-5H,6H2,1-2H3,(H3,13,15,18) |
| InChIKey | WVIZAETZMQYVJY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 155.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|