C19H20F2N2O4 — CID 9215041
N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-4-ethoxybenzamide (PubChem CID 9215041) has the molecular formula C19H20F2N2O4 and a molecular weight of 378.38 g/mol. Its IUPAC name is N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-4-ethoxybenzamide.
| Compound Name | N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 9215041 |
| Molecular Formula | C19H20F2N2O4 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C\c2cccc(OCC)c2OC(F)F)cc1 |
| InChI | InChI=1S/C19H20F2N2O4/c1-3-25-15-10-8-13(9-11-15)18(24)23-22-12-14-6-5-7-16(26-4-2)17(14)27-19(20)21/h5-12,19H,3-4H2,1-2H3,(H,23,24)/b22-12- |
| InChIKey | GROWOSHRKLOCPT-UUYOSTAYSA-N |
| XLogP | 3.85 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|