C21H26N2O7 — CID 4921158
N-[4-ethoxy-2-(2-hydroxypropanoylamino)phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 4921158) has the molecular formula C21H26N2O7 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-[4-ethoxy-2-(2-hydroxypropanoylamino)phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[4-ethoxy-2-(2-hydroxypropanoylamino)phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 4921158 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-[4-ethoxy-2-(2-hydroxypropanoylamino)phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(OC)c(OC)c(OC)c2)c(NC(=O)C(C)O)c1 |
| InChI | InChI=1S/C21H26N2O7/c1-6-30-14-7-8-15(16(11-14)23-20(25)12(2)24)22-21(26)13-9-17(27-3)19(29-5)18(10-13)28-4/h7-12,24H,6H2,1-5H3,(H,22,26)(H,23,25) |
| InChIKey | JKOISIFDPZQGKE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |