C32H32N2O8S2 — CID 4001036
3,4,5-trimethoxy-N-[2-[[2-[(3,4,5-trimethoxybenzoyl)amino]phenyl]disulfanyl]phenyl]benzamide (PubChem CID 4001036) has the molecular formula C32H32N2O8S2 and a molecular weight of 636.75 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-[[2-[(3,4,5-trimethoxybenzoyl)amino]phenyl]disulfanyl]phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-[[2-[(3,4,5-trimethoxybenzoyl)amino]phenyl]disulfanyl]phenyl]benzamide |
|---|---|
| PubChem CID | 4001036 |
| Molecular Formula | C32H32N2O8S2 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-[[2-[(3,4,5-trimethoxybenzoyl)amino]phenyl]disulfanyl]phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2SSc2ccccc2NC(=O)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C32H32N2O8S2/c1-37-23-15-19(16-24(38-2)29(23)41-5)31(35)33-21-11-7-9-13-27(21)43-44-28-14-10-8-12-22(28)34-32(36)20-17-25(39-3)30(42-6)26(18-20)40-4/h7-18H,1-6H3,(H,33,35)(H,34,36) |
| InChIKey | VKKIALLEBCJZHT-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|