C25H24N2O7 — CID 108927978
[3-[[2-[(3,4,5-trimethoxybenzoyl)amino]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108927978) has the molecular formula C25H24N2O7 and a molecular weight of 464.47 g/mol. Its IUPAC name is [3-[[2-[(3,4,5-trimethoxybenzoyl)amino]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[2-[(3,4,5-trimethoxybenzoyl)amino]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927978 |
| Molecular Formula | C25H24N2O7 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [3-[[2-[(3,4,5-trimethoxybenzoyl)amino]phenyl]carbamoyl]phenyl] acetate |
| SMILES | COc1cc(C(=O)Nc2ccccc2NC(=O)c2cccc(OC(C)=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H24N2O7/c1-15(28)34-18-9-7-8-16(12-18)24(29)26-19-10-5-6-11-20(19)27-25(30)17-13-21(31-2)23(33-4)22(14-17)32-3/h5-14H,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | GVMWLQQIDDZWOK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|