C18H23ClN2O4 — CID 157076630
N-[2-(dimethylamino)phenyl]-3,4,5-trimethoxybenzamide;hydrochloride (PubChem CID 157076630) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is N-[2-(dimethylamino)phenyl]-3,4,5-trimethoxybenzamide;hydrochloride.
| Compound Name | N-[2-(dimethylamino)phenyl]-3,4,5-trimethoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 157076630 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N-[2-(dimethylamino)phenyl]-3,4,5-trimethoxybenzamide;hydrochloride |
| SMILES | COc1cc(C(=O)Nc2ccccc2N(C)C)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C18H22N2O4.ClH/c1-20(2)14-9-7-6-8-13(14)19-18(21)12-10-15(22-3)17(24-5)16(11-12)23-4;/h6-11H,1-5H3,(H,19,21);1H |
| InChIKey | ADAVSPQFHXXSAR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |