C19H21NO6 — CID 17416979
methyl 2-methyl-6-[(3,4,5-trimethoxybenzoyl)amino]benzoate (PubChem CID 17416979) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is methyl 2-methyl-6-[(3,4,5-trimethoxybenzoyl)amino]benzoate.
| Compound Name | methyl 2-methyl-6-[(3,4,5-trimethoxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 17416979 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | methyl 2-methyl-6-[(3,4,5-trimethoxybenzoyl)amino]benzoate |
| SMILES | COC(=O)c1c(C)cccc1NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H21NO6/c1-11-7-6-8-13(16(11)19(22)26-5)20-18(21)12-9-14(23-2)17(25-4)15(10-12)24-3/h6-10H,1-5H3,(H,20,21) |
| InChIKey | XQDWGXJMUNTRAK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |