C22H30ClN3O7 — CID 154635848
2-[1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]-4-methylpent-3-enoxy]ethyl 2-aminoacetate;hydrochloride (PubChem CID 154635848) has the molecular formula C22H30ClN3O7 and a molecular weight of 483.95 g/mol. Its IUPAC name is 2-[1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]-4-methylpent-3-enoxy]ethyl 2-aminoacetate;hydrochloride.
| Compound Name | 2-[1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]-4-methylpent-3-enoxy]ethyl 2-aminoacetate;hydrochloride |
|---|---|
| PubChem CID | 154635848 |
| Molecular Formula | C22H30ClN3O7 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 2-[1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]-4-methylpent-3-enoxy]ethyl 2-aminoacetate;hydrochloride |
| SMILES | COc1cc(C(CC=C(C)C)OCCOC(=O)CN)c(OC)c2c(N=O)ccc(NO)c12.Cl |
| InChI | InChI=1S/C22H29N3O7.ClH/c1-13(2)5-8-17(31-9-10-32-19(26)12-23)14-11-18(29-3)20-15(24-27)6-7-16(25-28)21(20)22(14)30-4;/h5-7,11,17,24,27H,8-10,12,23H2,1-4H3;1H |
| InChIKey | NZXRQLBMPKXYMQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|