C25H23FO6 — CID 141325730
[1-(1,4-dimethoxy-5,8-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 4-fluorobenzoate (PubChem CID 141325730) has the molecular formula C25H23FO6 and a molecular weight of 438.45 g/mol. Its IUPAC name is [1-(1,4-dimethoxy-5,8-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 4-fluorobenzoate.
| Compound Name | [1-(1,4-dimethoxy-5,8-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 141325730 |
| Molecular Formula | C25H23FO6 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | [1-(1,4-dimethoxy-5,8-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 4-fluorobenzoate |
| SMILES | COc1cc(C(CC=C(C)C)OC(=O)c2ccc(F)cc2)c(OC)c2c1C(=O)C=CC2=O |
| InChI | InChI=1S/C25H23FO6/c1-14(2)5-12-20(32-25(29)15-6-8-16(26)9-7-15)17-13-21(30-3)22-18(27)10-11-19(28)23(22)24(17)31-4/h5-11,13,20H,12H2,1-4H3 |
| InChIKey | MECNPHJLKAXYBS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|