C26H32N2O5S2 — CID 155542997
S-[1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]nonyl] thiophene-2-carbothioate (PubChem CID 155542997) has the molecular formula C26H32N2O5S2 and a molecular weight of 516.69 g/mol. Its IUPAC name is S-[1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]nonyl] thiophene-2-carbothioate.
| Compound Name | S-[1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]nonyl] thiophene-2-carbothioate |
|---|---|
| PubChem CID | 155542997 |
| Molecular Formula | C26H32N2O5S2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | S-[1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]nonyl] thiophene-2-carbothioate |
| SMILES | CCCCCCCCC(SC(=O)c1cccs1)c1cc(OC)c2c(NO)ccc(N=O)c2c1OC |
| InChI | InChI=1S/C26H32N2O5S2/c1-4-5-6-7-8-9-11-21(35-26(29)22-12-10-15-34-22)17-16-20(32-2)23-18(27-30)13-14-19(28-31)24(23)25(17)33-3/h10,12-16,21,27,30H,4-9,11H2,1-3H3 |
| InChIKey | RMMDWOGZOYUGGV-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|