About heptyl thiophene-2-carboxylate
heptyl thiophene-2-carboxylate (PubChem CID 574115) has the molecular formula C12H18O2S
and a molecular weight of 226.34 g/mol. Its IUPAC name is heptyl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | heptyl thiophene-2-carboxylate |
| PubChem CID | 574115 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | heptyl thiophene-2-carboxylate |
| SMILES | CCCCCCCOC(=O)c1cccs1 |
| InChI | InChI=1S/C12H18O2S/c1-2-3-4-5-6-9-14-12(13)11-8-7-10-15-11/h7-8,10H,2-6,9H2,1H3 |
| InChIKey | GHJPQRYSNYFFLJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptyl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptyl thiophene-2-carboxylate?
The IUPAC name of heptyl thiophene-2-carboxylate (CID 574115) is heptyl thiophene-2-carboxylate.
What is the SMILES notation for heptyl thiophene-2-carboxylate?
The canonical SMILES for heptyl thiophene-2-carboxylate is CCCCCCCOC(=O)c1cccs1.
What is the InChIKey of heptyl thiophene-2-carboxylate?
The InChIKey is GHJPQRYSNYFFLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2S/c1-2-3-4-5-6-9-14-12(13)11-8-7-10-15-11/h7-8,10H,2-6,9H2,1H3.
What are the key properties of heptyl thiophene-2-carboxylate?
heptyl thiophene-2-carboxylate has a molecular weight of 226.34 g/mol, XLogP of 3.88, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl thiophene-2-carboxylate is sourced from PubChem (CID 574115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).