About 2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate
2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate (PubChem CID 174814348) has the molecular formula C10H14O4S
and a molecular weight of 230.28 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | 2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate |
| PubChem CID | 174814348 |
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate |
| SMILES | COCCOCCOC(=O)c1cccs1 |
| InChI | InChI=1S/C10H14O4S/c1-12-4-5-13-6-7-14-10(11)9-3-2-8-15-9/h2-3,8H,4-7H2,1H3 |
| InChIKey | UCIKVXLCNAQBHB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate?
The IUPAC name of 2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate (CID 174814348) is 2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate.
What is the SMILES notation for 2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate?
The canonical SMILES for 2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate is COCCOCCOC(=O)c1cccs1.
What is the InChIKey of 2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate?
The InChIKey is UCIKVXLCNAQBHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4S/c1-12-4-5-13-6-7-14-10(11)9-3-2-8-15-9/h2-3,8H,4-7H2,1H3.
What are the key properties of 2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate?
2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate has a molecular weight of 230.28 g/mol, XLogP of 1.57, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethoxy)ethyl thiophene-2-carboxylate is sourced from PubChem (CID 174814348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).