About 4-cyanobutyl thiophene-2-carboxylate
4-cyanobutyl thiophene-2-carboxylate (PubChem CID 132538634) has the molecular formula C10H11NO2S
and a molecular weight of 209.27 g/mol. Its IUPAC name is 4-cyanobutyl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | 4-cyanobutyl thiophene-2-carboxylate |
| PubChem CID | 132538634 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 4-cyanobutyl thiophene-2-carboxylate |
| SMILES | N#CCCCCOC(=O)c1cccs1 |
| InChI | InChI=1S/C10H11NO2S/c11-6-2-1-3-7-13-10(12)9-5-4-8-14-9/h4-5,8H,1-3,7H2 |
| InChIKey | YQRXBSGRMSWXBR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyanobutyl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyanobutyl thiophene-2-carboxylate?
The IUPAC name of 4-cyanobutyl thiophene-2-carboxylate (CID 132538634) is 4-cyanobutyl thiophene-2-carboxylate.
What is the SMILES notation for 4-cyanobutyl thiophene-2-carboxylate?
The canonical SMILES for 4-cyanobutyl thiophene-2-carboxylate is N#CCCCCOC(=O)c1cccs1.
What is the InChIKey of 4-cyanobutyl thiophene-2-carboxylate?
The InChIKey is YQRXBSGRMSWXBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S/c11-6-2-1-3-7-13-10(12)9-5-4-8-14-9/h4-5,8H,1-3,7H2.
What are the key properties of 4-cyanobutyl thiophene-2-carboxylate?
4-cyanobutyl thiophene-2-carboxylate has a molecular weight of 209.27 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyanobutyl thiophene-2-carboxylate is sourced from PubChem (CID 132538634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).