C13H16O4S — CID 21182205
4-(2-methylprop-2-enoyloxy)butyl thiophene-2-carboxylate (PubChem CID 21182205) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is 4-(2-methylprop-2-enoyloxy)butyl thiophene-2-carboxylate.
| Compound Name | 4-(2-methylprop-2-enoyloxy)butyl thiophene-2-carboxylate |
|---|---|
| PubChem CID | 21182205 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4-(2-methylprop-2-enoyloxy)butyl thiophene-2-carboxylate |
| SMILES | C=C(C)C(=O)OCCCCOC(=O)c1cccs1 |
| InChI | InChI=1S/C13H16O4S/c1-10(2)12(14)16-7-3-4-8-17-13(15)11-6-5-9-18-11/h5-6,9H,1,3-4,7-8H2,2H3 |
| InChIKey | PGCUROPZXQMKNT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|