About 2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride
2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride (PubChem CID 52998113) has the molecular formula C9H14ClNO2S
and a molecular weight of 235.74 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride |
| PubChem CID | 52998113 |
| Molecular Formula | C9H14ClNO2S |
| Molecular Weight | 235.74 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride |
| SMILES | CN(C)CCOC(=O)c1cccs1.Cl |
| InChI | InChI=1S/C9H13NO2S.ClH/c1-10(2)5-6-12-9(11)8-4-3-7-13-8;/h3-4,7H,5-6H2,1-2H3;1H |
| InChIKey | LOXFWEOFWHHBPT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.74 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride?
The IUPAC name of 2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride (CID 52998113) is 2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride.
What is the SMILES notation for 2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride?
The canonical SMILES for 2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride is CN(C)CCOC(=O)c1cccs1.Cl.
What is the InChIKey of 2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride?
The InChIKey is LOXFWEOFWHHBPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S.ClH/c1-10(2)5-6-12-9(11)8-4-3-7-13-8;/h3-4,7H,5-6H2,1-2H3;1H.
What are the key properties of 2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride?
2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride has a molecular weight of 235.74 g/mol, XLogP of 1.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl thiophene-2-carboxylate;hydrochloride is sourced from PubChem (CID 52998113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).