C25H36O6 — CID 135398413
5-[2,2-dimethyl-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)but-3-enoxy]pentan-1-ol (PubChem CID 135398413) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is 5-[2,2-dimethyl-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)but-3-enoxy]pentan-1-ol.
| Compound Name | 5-[2,2-dimethyl-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)but-3-enoxy]pentan-1-ol |
|---|---|
| PubChem CID | 135398413 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 5-[2,2-dimethyl-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)but-3-enoxy]pentan-1-ol |
| SMILES | C=CC(C)(C)C(OCCCCCO)c1cc(OC)c2c(OC)ccc(OC)c2c1OC |
| InChI | InChI=1S/C25H36O6/c1-8-25(2,3)24(31-15-11-9-10-14-26)17-16-20(29-6)21-18(27-4)12-13-19(28-5)22(21)23(17)30-7/h8,12-13,16,24,26H,1,9-11,14-15H2,2-7H3 |
| InChIKey | RFQKICWJTHSPIW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|