C14H21NO3S — CID 107703833
4-(6-hydroxyhexoxy)-3-methoxybenzenecarbothioamide (PubChem CID 107703833) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 4-(6-hydroxyhexoxy)-3-methoxybenzenecarbothioamide.
| Compound Name | 4-(6-hydroxyhexoxy)-3-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 107703833 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-(6-hydroxyhexoxy)-3-methoxybenzenecarbothioamide |
| SMILES | COc1cc(C(N)=S)ccc1OCCCCCCO |
| InChI | InChI=1S/C14H21NO3S/c1-17-13-10-11(14(15)19)6-7-12(13)18-9-5-3-2-4-8-16/h6-7,10,16H,2-5,8-9H2,1H3,(H2,15,19) |
| InChIKey | VPYXJSCOKSTRKJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|