C13H19NO4S2 — CID 65092857
4-(3-ethylsulfonylpropoxy)-3-methoxybenzenecarbothioamide (PubChem CID 65092857) has the molecular formula C13H19NO4S2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 4-(3-ethylsulfonylpropoxy)-3-methoxybenzenecarbothioamide.
| Compound Name | 4-(3-ethylsulfonylpropoxy)-3-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 65092857 |
| Molecular Formula | C13H19NO4S2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 4-(3-ethylsulfonylpropoxy)-3-methoxybenzenecarbothioamide |
| SMILES | CCS(=O)(=O)CCCOc1ccc(C(N)=S)cc1OC |
| InChI | InChI=1S/C13H19NO4S2/c1-3-20(15,16)8-4-7-18-11-6-5-10(13(14)19)9-12(11)17-2/h5-6,9H,3-4,7-8H2,1-2H3,(H2,14,19) |
| InChIKey | PTWBLOPWZJOTAA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|