C10H12FNO2S — CID 80693896
4-(2-fluoroethoxy)-3-methoxybenzenecarbothioamide (PubChem CID 80693896) has the molecular formula C10H12FNO2S and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-(2-fluoroethoxy)-3-methoxybenzenecarbothioamide.
| Compound Name | 4-(2-fluoroethoxy)-3-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 80693896 |
| Molecular Formula | C10H12FNO2S |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 4-(2-fluoroethoxy)-3-methoxybenzenecarbothioamide |
| SMILES | COc1cc(C(N)=S)ccc1OCCF |
| InChI | InChI=1S/C10H12FNO2S/c1-13-9-6-7(10(12)15)2-3-8(9)14-5-4-11/h2-3,6H,4-5H2,1H3,(H2,12,15) |
| InChIKey | WDVNXRKPEOCULE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|