C18H21NO3S — CID 22681311
4-[2-(2,6-dimethylphenoxy)ethoxy]-3-methoxybenzenecarbothioamide (PubChem CID 22681311) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-[2-(2,6-dimethylphenoxy)ethoxy]-3-methoxybenzenecarbothioamide.
| Compound Name | 4-[2-(2,6-dimethylphenoxy)ethoxy]-3-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 22681311 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 4-[2-(2,6-dimethylphenoxy)ethoxy]-3-methoxybenzenecarbothioamide |
| SMILES | COc1cc(C(N)=S)ccc1OCCOc1c(C)cccc1C |
| InChI | InChI=1S/C18H21NO3S/c1-12-5-4-6-13(2)17(12)22-10-9-21-15-8-7-14(18(19)23)11-16(15)20-3/h4-8,11H,9-10H2,1-3H3,(H2,19,23) |
| InChIKey | JIMSESYXCUDWPS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|