C15H17NO5 — CID 15362247
1,4,5,8-tetramethoxynaphthalene-2-carboxamide (PubChem CID 15362247) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 1,4,5,8-tetramethoxynaphthalene-2-carboxamide.
| Compound Name | 1,4,5,8-tetramethoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 15362247 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1,4,5,8-tetramethoxynaphthalene-2-carboxamide |
| SMILES | COc1ccc(OC)c2c(OC)c(C(N)=O)cc(OC)c12 |
| InChI | InChI=1S/C15H17NO5/c1-18-9-5-6-10(19-2)13-12(9)11(20-3)7-8(15(16)17)14(13)21-4/h5-7H,1-4H3,(H2,16,17) |
| InChIKey | YBNLBYYQHSNXOQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |