C14H14N2O4 — CID 100971321
4,8-dimethoxynaphthalene-1,5-dicarboxamide (PubChem CID 100971321) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 4,8-dimethoxynaphthalene-1,5-dicarboxamide.
| Compound Name | 4,8-dimethoxynaphthalene-1,5-dicarboxamide |
|---|---|
| PubChem CID | 100971321 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4,8-dimethoxynaphthalene-1,5-dicarboxamide |
| SMILES | COc1ccc(C(N)=O)c2c(OC)ccc(C(N)=O)c12 |
| InChI | InChI=1S/C14H14N2O4/c1-19-9-5-3-8(14(16)18)12-10(20-2)6-4-7(11(9)12)13(15)17/h3-6H,1-2H3,(H2,15,17)(H2,16,18) |
| InChIKey | DEAKQGQBBDVXLI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |