C10H11NO5 — CID 90976735
6-carbamoyl-2,3-dimethoxybenzoic acid (PubChem CID 90976735) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is 6-carbamoyl-2,3-dimethoxybenzoic acid.
| Compound Name | 6-carbamoyl-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 90976735 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 6-carbamoyl-2,3-dimethoxybenzoic acid |
| SMILES | COc1ccc(C(N)=O)c(C(=O)O)c1OC |
| InChI | InChI=1S/C10H11NO5/c1-15-6-4-3-5(9(11)12)7(10(13)14)8(6)16-2/h3-4H,1-2H3,(H2,11,12)(H,13,14) |
| InChIKey | GTCMRECPPNFKLU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |