C20H22O10 — CID 22420303
2-(2-carboxy-3,4-dimethoxyphenyl)-3,4,5,6-tetramethoxybenzoic acid (PubChem CID 22420303) has the molecular formula C20H22O10 and a molecular weight of 422.39 g/mol. Its IUPAC name is 2-(2-carboxy-3,4-dimethoxyphenyl)-3,4,5,6-tetramethoxybenzoic acid.
| Compound Name | 2-(2-carboxy-3,4-dimethoxyphenyl)-3,4,5,6-tetramethoxybenzoic acid |
|---|---|
| PubChem CID | 22420303 |
| Molecular Formula | C20H22O10 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-(2-carboxy-3,4-dimethoxyphenyl)-3,4,5,6-tetramethoxybenzoic acid |
| SMILES | COc1ccc(-c2c(OC)c(OC)c(OC)c(OC)c2C(=O)O)c(C(=O)O)c1OC |
| InChI | InChI=1S/C20H22O10/c1-25-10-8-7-9(12(19(21)22)14(10)26-2)11-13(20(23)24)16(28-4)18(30-6)17(29-5)15(11)27-3/h7-8H,1-6H3,(H,21,22)(H,23,24) |
| InChIKey | FOBVSJDRLCAJJU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |