C21H15N3O7 — CID 91638654
6-(6-hydroxy-5-oxo-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-10-yl)-2,3-dimethoxybenzoic acid (PubChem CID 91638654) has the molecular formula C21H15N3O7 and a molecular weight of 421.37 g/mol. Its IUPAC name is 6-(6-hydroxy-5-oxo-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-10-yl)-2,3-dimethoxybenzoic acid.
| Compound Name | 6-(6-hydroxy-5-oxo-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-10-yl)-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 91638654 |
| Molecular Formula | C21H15N3O7 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 6-(6-hydroxy-5-oxo-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-10-yl)-2,3-dimethoxybenzoic acid |
| SMILES | COc1ccc(-c2c3c[nH][nH]c3nc3c2oc2c(O)c(=O)ccc23)c(C(=O)O)c1OC |
| InChI | InChI=1S/C21H15N3O7/c1-29-12-6-4-8(14(21(27)28)18(12)30-2)13-10-7-22-24-20(10)23-15-9-3-5-11(25)16(26)17(9)31-19(13)15/h3-7,26H,1-2H3,(H,27,28)(H2,22,23,24) |
| InChIKey | YPHMOZHYOUQFBD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 150.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |