C23H21N3O5 — CID 71826492
10-(3,4-dihydroxy-5-methoxyphenyl)-6-methyl-14-propan-2-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one (PubChem CID 71826492) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is 10-(3,4-dihydroxy-5-methoxyphenyl)-6-methyl-14-propan-2-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one.
| Compound Name | 10-(3,4-dihydroxy-5-methoxyphenyl)-6-methyl-14-propan-2-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one |
|---|---|
| PubChem CID | 71826492 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 10-(3,4-dihydroxy-5-methoxyphenyl)-6-methyl-14-propan-2-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one |
| SMILES | COc1cc(-c2c3c[nH]n(C(C)C)c3nc3c2oc2c(C)c(=O)ccc23)cc(O)c1O |
| InChI | InChI=1S/C23H21N3O5/c1-10(2)26-23-14(9-24-26)18(12-7-16(28)20(29)17(8-12)30-4)22-19(25-23)13-5-6-15(27)11(3)21(13)31-22/h5-10,24,28-29H,1-4H3 |
| InChIKey | WSNLZDMKTGVTSO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|