C20H15N3O4 — CID 91640306
10-(3-hydroxy-4-methoxyphenyl)-6-methyl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one (PubChem CID 91640306) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 10-(3-hydroxy-4-methoxyphenyl)-6-methyl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one.
| Compound Name | 10-(3-hydroxy-4-methoxyphenyl)-6-methyl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one |
|---|---|
| PubChem CID | 91640306 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 10-(3-hydroxy-4-methoxyphenyl)-6-methyl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one |
| SMILES | COc1ccc(-c2c3c[nH][nH]c3nc3c2oc2c(C)c(=O)ccc23)cc1O |
| InChI | InChI=1S/C20H15N3O4/c1-9-13(24)5-4-11-17-19(27-18(9)11)16(12-8-21-23-20(12)22-17)10-3-6-15(26-2)14(25)7-10/h3-8,25H,1-2H3,(H2,21,22,23) |
| InChIKey | JDCZSIYOUXDVCZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |