C17H22O7 — CID 174728392
1-(1-hydroxy-4,5,8-trimethoxynaphthalen-2-yl)ethanone;methylperoxymethane (PubChem CID 174728392) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is 1-(1-hydroxy-4,5,8-trimethoxynaphthalen-2-yl)ethanone;methylperoxymethane.
| Compound Name | 1-(1-hydroxy-4,5,8-trimethoxynaphthalen-2-yl)ethanone;methylperoxymethane |
|---|---|
| PubChem CID | 174728392 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-(1-hydroxy-4,5,8-trimethoxynaphthalen-2-yl)ethanone;methylperoxymethane |
| SMILES | COOC.COc1ccc(OC)c2c(O)c(C(C)=O)cc(OC)c12 |
| InChI | InChI=1S/C15H16O5.C2H6O2/c1-8(16)9-7-12(20-4)13-10(18-2)5-6-11(19-3)14(13)15(9)17;1-3-4-2/h5-7,17H,1-4H3;1-2H3 |
| InChIKey | OZSIWYQYVGAFSY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|